C34H34ClFN4O5 — CID 147828769
(E)-5-[(4aR,7aS)-2,3,4a,5,7,7a-hexahydro-[1,4]dioxino[2,3-c]pyrrol-6-yl]-1-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]-7-ethoxyquinazolin-6-yl]pent-3-en-2-one (PubChem CID 147828769) has the molecular formula C34H34ClFN4O5 and a molecular weight of 633.12 g/mol. Its IUPAC name is (E)-5-[(4aR,7aS)-2,3,4a,5,7,7a-hexahydro-[1,4]dioxino[2,3-c]pyrrol-6-yl]-1-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]-7-ethoxyquinazolin-6-yl]pent-3-en-2-one.
| Compound Name | (E)-5-[(4aR,7aS)-2,3,4a,5,7,7a-hexahydro-[1,4]dioxino[2,3-c]pyrrol-6-yl]-1-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]-7-ethoxyquinazolin-6-yl]pent-3-en-2-one |
|---|---|
| PubChem CID | 147828769 |
| Molecular Formula | C34H34ClFN4O5 |
| Molecular Weight | 633.12 g/mol |
| Exact Mass | 632.22 |
| IUPAC Name | (E)-5-[(4aR,7aS)-2,3,4a,5,7,7a-hexahydro-[1,4]dioxino[2,3-c]pyrrol-6-yl]-1-[4-[3-chloro-4-[(3-fluorophenyl)methoxy]anilino]-7-ethoxyquinazolin-6-yl]pent-3-en-2-one |
| SMILES | CCOc1cc2ncnc(Nc3ccc(OCc4cccc(F)c4)c(Cl)c3)c2cc1CC(=O)/C=C/CN1C[C@@H]2OCCO[C@@H]2C1 |
| InChI | InChI=1S/C34H34ClFN4O5/c1-2-42-31-17-29-27(15-23(31)14-26(41)7-4-10-40-18-32-33(19-40)44-12-11-43-32)34(38-21-37-29)39-25-8-9-30(28(35)16-25)45-20-22-5-3-6-24(36)13-22/h3-9,13,15-17,21,32-33H,2,10-12,14,18-20H2,1H3,(H,37,38,39)/b7-4+/t32-,33+ |
| InChIKey | HQRHQZHWJOMSKE-QMDKTHDJSA-N |
| XLogP | 5.91 |
| TPSA | 95.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.12 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|