C20H19ClF2N2O — CID 147829618
N-[(3-chloro-2,6-difluorophenyl)methyl]spiro[1,4-dihydroquinoline-3,4'-oxane]-2-imine (PubChem CID 147829618) has the molecular formula C20H19ClF2N2O and a molecular weight of 376.83 g/mol. Its IUPAC name is N-[(3-chloro-2,6-difluorophenyl)methyl]spiro[1,4-dihydroquinoline-3,4'-oxane]-2-imine.
| Compound Name | N-[(3-chloro-2,6-difluorophenyl)methyl]spiro[1,4-dihydroquinoline-3,4'-oxane]-2-imine |
|---|---|
| PubChem CID | 147829618 |
| Molecular Formula | C20H19ClF2N2O |
| Molecular Weight | 376.83 g/mol |
| Exact Mass | 376.12 |
| IUPAC Name | N-[(3-chloro-2,6-difluorophenyl)methyl]spiro[1,4-dihydroquinoline-3,4'-oxane]-2-imine |
| SMILES | Fc1ccc(Cl)c(F)c1C/N=C1\Nc2ccccc2CC12CCOCC2 |
| InChI | InChI=1S/C20H19ClF2N2O/c21-15-5-6-16(22)14(18(15)23)12-24-19-20(7-9-26-10-8-20)11-13-3-1-2-4-17(13)25-19/h1-6H,7-12H2,(H,24,25) |
| InChIKey | HQVKUDKLVSLMRR-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 33.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.83 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|