C23H27N5O2S — CID 147830303
5-[(E)-2-(3-aminophenyl)ethenyl]-N-(4-piperidin-4-ylsulfonylcyclohexa-1,3-dien-1-yl)pyrimidin-2-amine (PubChem CID 147830303) has the molecular formula C23H27N5O2S and a molecular weight of 437.57 g/mol. Its IUPAC name is 5-[(E)-2-(3-aminophenyl)ethenyl]-N-(4-piperidin-4-ylsulfonylcyclohexa-1,3-dien-1-yl)pyrimidin-2-amine.
| Compound Name | 5-[(E)-2-(3-aminophenyl)ethenyl]-N-(4-piperidin-4-ylsulfonylcyclohexa-1,3-dien-1-yl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 147830303 |
| Molecular Formula | C23H27N5O2S |
| Molecular Weight | 437.57 g/mol |
| Exact Mass | 437.19 |
| IUPAC Name | 5-[(E)-2-(3-aminophenyl)ethenyl]-N-(4-piperidin-4-ylsulfonylcyclohexa-1,3-dien-1-yl)pyrimidin-2-amine |
| SMILES | Nc1cccc(/C=C/c2cnc(NC3=CC=C(S(=O)(=O)C4CCNCC4)CC3)nc2)c1 |
| InChI | InChI=1S/C23H27N5O2S/c24-19-3-1-2-17(14-19)4-5-18-15-26-23(27-16-18)28-20-6-8-21(9-7-20)31(29,30)22-10-12-25-13-11-22/h1-6,8,14-16,22,25H,7,9-13,24H2,(H,26,27,28)/b5-4+ |
| InChIKey | HQYVMKSEOJJWSH-SNAWJCMRSA-N |
| XLogP | 3.37 |
| TPSA | 110.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.57 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|