About (4,6-dimethoxy-1,3,5-triazin-2-yl) 4-methoxybenzoate
(4,6-dimethoxy-1,3,5-triazin-2-yl) 4-methoxybenzoate (PubChem CID 14783084) has the molecular formula C13H13N3O5
and a molecular weight of 291.26 g/mol. Its IUPAC name is (4,6-dimethoxy-1,3,5-triazin-2-yl) 4-methoxybenzoate.
Molecular Properties
| Compound Name | (4,6-dimethoxy-1,3,5-triazin-2-yl) 4-methoxybenzoate |
| PubChem CID | 14783084 |
| Molecular Formula | C13H13N3O5 |
| Molecular Weight | 291.26 g/mol |
| Exact Mass | 291.09 |
| IUPAC Name | (4,6-dimethoxy-1,3,5-triazin-2-yl) 4-methoxybenzoate |
| SMILES | COc1ccc(C(=O)Oc2nc(OC)nc(OC)n2)cc1 |
| InChI | InChI=1S/C13H13N3O5/c1-18-9-6-4-8(5-7-9)10(17)21-13-15-11(19-2)14-12(16-13)20-3/h4-7H,1-3H3 |
| InChIKey | LSOYSPLPFNCUOE-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 92.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 291.26 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze (4,6-dimethoxy-1,3,5-triazin-2-yl) 4-methoxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4,6-dimethoxy-1,3,5-triazin-2-yl) 4-methoxybenzoate?
The IUPAC name of (4,6-dimethoxy-1,3,5-triazin-2-yl) 4-methoxybenzoate (CID 14783084) is (4,6-dimethoxy-1,3,5-triazin-2-yl) 4-methoxybenzoate.
What is the SMILES notation for (4,6-dimethoxy-1,3,5-triazin-2-yl) 4-methoxybenzoate?
The canonical SMILES for (4,6-dimethoxy-1,3,5-triazin-2-yl) 4-methoxybenzoate is COc1ccc(C(=O)Oc2nc(OC)nc(OC)n2)cc1.
What is the InChIKey of (4,6-dimethoxy-1,3,5-triazin-2-yl) 4-methoxybenzoate?
The InChIKey is LSOYSPLPFNCUOE-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13N3O5/c1-18-9-6-4-8(5-7-9)10(17)21-13-15-11(19-2)14-12(16-13)20-3/h4-7H,1-3H3.
What are the key properties of (4,6-dimethoxy-1,3,5-triazin-2-yl) 4-methoxybenzoate?
(4,6-dimethoxy-1,3,5-triazin-2-yl) 4-methoxybenzoate has a molecular weight of 291.26 g/mol, XLogP of 1.12, 5 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for (4,6-dimethoxy-1,3,5-triazin-2-yl) 4-methoxybenzoate is sourced from PubChem (CID 14783084), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).