About (4S)-4-benzyl-3-[(2S)-3,3-dimethoxy-2-methylpropanoyl]-1,3-oxazolidin-2-one
(4S)-4-benzyl-3-[(2S)-3,3-dimethoxy-2-methylpropanoyl]-1,3-oxazolidin-2-one (PubChem CID 14783203) has the molecular formula C16H21NO5
and a molecular weight of 307.35 g/mol. Its IUPAC name is (4S)-4-benzyl-3-[(2S)-3,3-dimethoxy-2-methylpropanoyl]-1,3-oxazolidin-2-one.
Molecular Properties
| Compound Name | (4S)-4-benzyl-3-[(2S)-3,3-dimethoxy-2-methylpropanoyl]-1,3-oxazolidin-2-one |
| PubChem CID | 14783203 |
| Molecular Formula | C16H21NO5 |
| Molecular Weight | 307.35 g/mol |
| Exact Mass | 307.14 |
| IUPAC Name | (4S)-4-benzyl-3-[(2S)-3,3-dimethoxy-2-methylpropanoyl]-1,3-oxazolidin-2-one |
| SMILES | COC(OC)[C@H](C)C(=O)N1C(=O)OC[C@@H]1Cc1ccccc1 |
| InChI | InChI=1S/C16H21NO5/c1-11(15(20-2)21-3)14(18)17-13(10-22-16(17)19)9-12-7-5-4-6-8-12/h4-8,11,13,15H,9-10H2,1-3H3/t11-,13+/m1/s1 |
| InChIKey | UNFPVMFZVNLPSW-YPMHNXCESA-N |
| XLogP | 1.83 |
| TPSA | 65.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 307.35 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze (4S)-4-benzyl-3-[(2S)-3,3-dimethoxy-2-methylpropanoyl]-1,3-oxazolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4S)-4-benzyl-3-[(2S)-3,3-dimethoxy-2-methylpropanoyl]-1,3-oxazolidin-2-one?
The IUPAC name of (4S)-4-benzyl-3-[(2S)-3,3-dimethoxy-2-methylpropanoyl]-1,3-oxazolidin-2-one (CID 14783203) is (4S)-4-benzyl-3-[(2S)-3,3-dimethoxy-2-methylpropanoyl]-1,3-oxazolidin-2-one.
What is the SMILES notation for (4S)-4-benzyl-3-[(2S)-3,3-dimethoxy-2-methylpropanoyl]-1,3-oxazolidin-2-one?
The canonical SMILES for (4S)-4-benzyl-3-[(2S)-3,3-dimethoxy-2-methylpropanoyl]-1,3-oxazolidin-2-one is COC(OC)[C@H](C)C(=O)N1C(=O)OC[C@@H]1Cc1ccccc1.
What is the InChIKey of (4S)-4-benzyl-3-[(2S)-3,3-dimethoxy-2-methylpropanoyl]-1,3-oxazolidin-2-one?
The InChIKey is UNFPVMFZVNLPSW-YPMHNXCESA-N. The full InChI is InChI=1S/C16H21NO5/c1-11(15(20-2)21-3)14(18)17-13(10-22-16(17)19)9-12-7-5-4-6-8-12/h4-8,11,13,15H,9-10H2,1-3H3/t11-,13+/m1/s1.
What are the key properties of (4S)-4-benzyl-3-[(2S)-3,3-dimethoxy-2-methylpropanoyl]-1,3-oxazolidin-2-one?
(4S)-4-benzyl-3-[(2S)-3,3-dimethoxy-2-methylpropanoyl]-1,3-oxazolidin-2-one has a molecular weight of 307.35 g/mol, XLogP of 1.83, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for (4S)-4-benzyl-3-[(2S)-3,3-dimethoxy-2-methylpropanoyl]-1,3-oxazolidin-2-one is sourced from PubChem (CID 14783203), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).