C16H19N5 — CID 14783685
1-ethyl-4-piperidin-1-yl-[1,2,4]triazolo[4,3-a]quinoxaline (PubChem CID 14783685) has the molecular formula C16H19N5 and a molecular weight of 281.36 g/mol. Its IUPAC name is 1-ethyl-4-piperidin-1-yl-[1,2,4]triazolo[4,3-a]quinoxaline.
| Compound Name | 1-ethyl-4-piperidin-1-yl-[1,2,4]triazolo[4,3-a]quinoxaline |
|---|---|
| PubChem CID | 14783685 |
| Molecular Formula | C16H19N5 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.16 |
| IUPAC Name | 1-ethyl-4-piperidin-1-yl-[1,2,4]triazolo[4,3-a]quinoxaline |
| SMILES | CCc1nnc2c(N3CCCCC3)nc3ccccc3n12 |
| InChI | InChI=1S/C16H19N5/c1-2-14-18-19-16-15(20-10-6-3-7-11-20)17-12-8-4-5-9-13(12)21(14)16/h4-5,8-9H,2-3,6-7,10-11H2,1H3 |
| InChIKey | YVAOYSFLXFWIRD-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 46.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |