C27H31N4O3+ — CID 14783745
4-[[3-(cyclopropylmethyl)-4a,9-dihydroxy-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]-methylamino]benzenediazonium (PubChem CID 14783745) has the molecular formula C27H31N4O3+ and a molecular weight of 459.57 g/mol. Its IUPAC name is 4-[[3-(cyclopropylmethyl)-4a,9-dihydroxy-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]-methylamino]benzenediazonium.
| Compound Name | 4-[[3-(cyclopropylmethyl)-4a,9-dihydroxy-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]-methylamino]benzenediazonium |
|---|---|
| PubChem CID | 14783745 |
| Molecular Formula | C27H31N4O3+ |
| Molecular Weight | 459.57 g/mol |
| Exact Mass | 459.24 |
| IUPAC Name | 4-[[3-(cyclopropylmethyl)-4a,9-dihydroxy-1,2,4,5,6,7,7a,13-octahydro-4,12-methanobenzofuro[3,2-e]isoquinolin-7-yl]-methylamino]benzenediazonium |
| SMILES | CN(c1ccc([N+]#N)cc1)C1CCC2(O)C3Cc4ccc(O)c5c4C2(CCN3CC2CC2)C1O5 |
| InChI | InChI=1S/C27H30N4O3/c1-30(19-7-5-18(29-28)6-8-19)20-10-11-27(33)22-14-17-4-9-21(32)24-23(17)26(27,25(20)34-24)12-13-31(22)15-16-2-3-16/h4-9,16,20,22,25,33H,2-3,10-15H2,1H3/p+1 |
| InChIKey | YWQHZAFCJGFSEL-UHFFFAOYSA-O |
| XLogP | 3.95 |
| TPSA | 84.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 459.57 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Azo_group', 'substructure': 'N/A'} |
|---|