C10H8F4N2O4S — CID 147838765
2-[[2,3,5,6-tetrafluoro-4-(methylideneamino)benzoyl]amino]ethanesulfonic acid (PubChem CID 147838765) has the molecular formula C10H8F4N2O4S and a molecular weight of 328.24 g/mol. Its IUPAC name is 2-[[2,3,5,6-tetrafluoro-4-(methylideneamino)benzoyl]amino]ethanesulfonic acid.
| Compound Name | 2-[[2,3,5,6-tetrafluoro-4-(methylideneamino)benzoyl]amino]ethanesulfonic acid |
|---|---|
| PubChem CID | 147838765 |
| Molecular Formula | C10H8F4N2O4S |
| Molecular Weight | 328.24 g/mol |
| Exact Mass | 328.01 |
| IUPAC Name | 2-[[2,3,5,6-tetrafluoro-4-(methylideneamino)benzoyl]amino]ethanesulfonic acid |
| SMILES | C=Nc1c(F)c(F)c(C(=O)NCCS(=O)(=O)O)c(F)c1F |
| InChI | InChI=1S/C10H8F4N2O4S/c1-15-9-7(13)5(11)4(6(12)8(9)14)10(17)16-2-3-21(18,19)20/h1-3H2,(H,16,17)(H,18,19,20) |
| InChIKey | HSNXROXVTGSTQS-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 95.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.24 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|