About ethyl 3-[2-(3-fluorophenyl)-1,3-thiazol-4-yl]benzoate
ethyl 3-[2-(3-fluorophenyl)-1,3-thiazol-4-yl]benzoate (PubChem CID 147839228) has the molecular formula C18H14FNO2S
and a molecular weight of 327.38 g/mol. Its IUPAC name is ethyl 3-[2-(3-fluorophenyl)-1,3-thiazol-4-yl]benzoate.
Molecular Properties
| Compound Name | ethyl 3-[2-(3-fluorophenyl)-1,3-thiazol-4-yl]benzoate |
| PubChem CID | 147839228 |
| Molecular Formula | C18H14FNO2S |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.07 |
| IUPAC Name | ethyl 3-[2-(3-fluorophenyl)-1,3-thiazol-4-yl]benzoate |
| SMILES | CCOC(=O)c1cccc(-c2csc(-c3cccc(F)c3)n2)c1 |
| InChI | InChI=1S/C18H14FNO2S/c1-2-22-18(21)14-7-3-5-12(9-14)16-11-23-17(20-16)13-6-4-8-15(19)10-13/h3-11H,2H2,1H3 |
| InChIKey | HSQFUORVVKYAIE-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 3-[2-(3-fluorophenyl)-1,3-thiazol-4-yl]benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-[2-(3-fluorophenyl)-1,3-thiazol-4-yl]benzoate?
The IUPAC name of ethyl 3-[2-(3-fluorophenyl)-1,3-thiazol-4-yl]benzoate (CID 147839228) is ethyl 3-[2-(3-fluorophenyl)-1,3-thiazol-4-yl]benzoate.
What is the SMILES notation for ethyl 3-[2-(3-fluorophenyl)-1,3-thiazol-4-yl]benzoate?
The canonical SMILES for ethyl 3-[2-(3-fluorophenyl)-1,3-thiazol-4-yl]benzoate is CCOC(=O)c1cccc(-c2csc(-c3cccc(F)c3)n2)c1.
What is the InChIKey of ethyl 3-[2-(3-fluorophenyl)-1,3-thiazol-4-yl]benzoate?
The InChIKey is HSQFUORVVKYAIE-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14FNO2S/c1-2-22-18(21)14-7-3-5-12(9-14)16-11-23-17(20-16)13-6-4-8-15(19)10-13/h3-11H,2H2,1H3.
What are the key properties of ethyl 3-[2-(3-fluorophenyl)-1,3-thiazol-4-yl]benzoate?
ethyl 3-[2-(3-fluorophenyl)-1,3-thiazol-4-yl]benzoate has a molecular weight of 327.38 g/mol, XLogP of 4.79, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-[2-(3-fluorophenyl)-1,3-thiazol-4-yl]benzoate is sourced from PubChem (CID 147839228), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).