C22H34O3S — CID 14784013
[(1S,2R,4R)-2-bicyclo[2.2.1]heptanyl] 2,4,6-tri(propan-2-yl)benzenesulfonate (PubChem CID 14784013) has the molecular formula C22H34O3S and a molecular weight of 378.58 g/mol. Its IUPAC name is [(1S,2R,4R)-2-bicyclo[2.2.1]heptanyl] 2,4,6-tri(propan-2-yl)benzenesulfonate.
| Compound Name | [(1S,2R,4R)-2-bicyclo[2.2.1]heptanyl] 2,4,6-tri(propan-2-yl)benzenesulfonate |
|---|---|
| PubChem CID | 14784013 |
| Molecular Formula | C22H34O3S |
| Molecular Weight | 378.58 g/mol |
| Exact Mass | 378.22 |
| IUPAC Name | [(1S,2R,4R)-2-bicyclo[2.2.1]heptanyl] 2,4,6-tri(propan-2-yl)benzenesulfonate |
| SMILES | CC(C)c1cc(C(C)C)c(S(=O)(=O)O[C@@H]2C[C@@H]3CC[C@H]2C3)c(C(C)C)c1 |
| InChI | InChI=1S/C22H34O3S/c1-13(2)18-11-19(14(3)4)22(20(12-18)15(5)6)26(23,24)25-21-10-16-7-8-17(21)9-16/h11-17,21H,7-10H2,1-6H3/t16-,17+,21-/m1/s1 |
| InChIKey | USNIXVPYSBPFFK-LLGFUMIMSA-N |
| XLogP | 5.95 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.58 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|