C16H20N4O2 — CID 147840970
11-tert-butyl-5-cyclobutyl-1,5,8,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),8,10-triene-2,6-dione (PubChem CID 147840970) has the molecular formula C16H20N4O2 and a molecular weight of 300.36 g/mol. Its IUPAC name is 11-tert-butyl-5-cyclobutyl-1,5,8,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),8,10-triene-2,6-dione.
| Compound Name | 11-tert-butyl-5-cyclobutyl-1,5,8,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),8,10-triene-2,6-dione |
|---|---|
| PubChem CID | 147840970 |
| Molecular Formula | C16H20N4O2 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | 11-tert-butyl-5-cyclobutyl-1,5,8,12-tetrazatricyclo[7.3.0.03,7]dodeca-3(7),8,10-triene-2,6-dione |
| SMILES | CC(C)(C)c1cc2nc3c(c(=O)n2[nH]1)CN(C1CCC1)C3=O |
| InChI | InChI=1S/C16H20N4O2/c1-16(2,3)11-7-12-17-13-10(14(21)20(12)18-11)8-19(15(13)22)9-5-4-6-9/h7,9,18H,4-6,8H2,1-3H3 |
| InChIKey | BFTRNMJZLKNMIK-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 70.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |