About 6,6-dichloro-1-methyl-3-propoxy-3lambda5-phosphabicyclo[3.1.0]hexane 3-oxide
6,6-dichloro-1-methyl-3-propoxy-3lambda5-phosphabicyclo[3.1.0]hexane 3-oxide (PubChem CID 14784292) has the molecular formula C9H15Cl2O2P
and a molecular weight of 257.10 g/mol. Its IUPAC name is 6,6-dichloro-1-methyl-3-propoxy-3lambda5-phosphabicyclo[3.1.0]hexane 3-oxide.
Molecular Properties
| Compound Name | 6,6-dichloro-1-methyl-3-propoxy-3lambda5-phosphabicyclo[3.1.0]hexane 3-oxide |
| PubChem CID | 14784292 |
| Molecular Formula | C9H15Cl2O2P |
| Molecular Weight | 257.10 g/mol |
| Exact Mass | 256.02 |
| IUPAC Name | 6,6-dichloro-1-methyl-3-propoxy-3lambda5-phosphabicyclo[3.1.0]hexane 3-oxide |
| SMILES | CCCOP1(=O)CC2C(Cl)(Cl)C2(C)C1 |
| InChI | InChI=1S/C9H15Cl2O2P/c1-3-4-13-14(12)5-7-8(2,6-14)9(7,10)11/h7H,3-6H2,1-2H3 |
| InChIKey | MKBGCQMPOCMACU-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 257.10 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 6,6-dichloro-1-methyl-3-propoxy-3lambda5-phosphabicyclo[3.1.0]hexane 3-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6,6-dichloro-1-methyl-3-propoxy-3lambda5-phosphabicyclo[3.1.0]hexane 3-oxide?
The IUPAC name of 6,6-dichloro-1-methyl-3-propoxy-3lambda5-phosphabicyclo[3.1.0]hexane 3-oxide (CID 14784292) is 6,6-dichloro-1-methyl-3-propoxy-3lambda5-phosphabicyclo[3.1.0]hexane 3-oxide.
What is the SMILES notation for 6,6-dichloro-1-methyl-3-propoxy-3lambda5-phosphabicyclo[3.1.0]hexane 3-oxide?
The canonical SMILES for 6,6-dichloro-1-methyl-3-propoxy-3lambda5-phosphabicyclo[3.1.0]hexane 3-oxide is CCCOP1(=O)CC2C(Cl)(Cl)C2(C)C1.
What is the InChIKey of 6,6-dichloro-1-methyl-3-propoxy-3lambda5-phosphabicyclo[3.1.0]hexane 3-oxide?
The InChIKey is MKBGCQMPOCMACU-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H15Cl2O2P/c1-3-4-13-14(12)5-7-8(2,6-14)9(7,10)11/h7H,3-6H2,1-2H3.
What are the key properties of 6,6-dichloro-1-methyl-3-propoxy-3lambda5-phosphabicyclo[3.1.0]hexane 3-oxide?
6,6-dichloro-1-methyl-3-propoxy-3lambda5-phosphabicyclo[3.1.0]hexane 3-oxide has a molecular weight of 257.10 g/mol, XLogP of 3.51, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6,6-dichloro-1-methyl-3-propoxy-3lambda5-phosphabicyclo[3.1.0]hexane 3-oxide is sourced from PubChem (CID 14784292), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).