C5H7NO — CID 14784415
4-methyl-1,2-dihydropyrrol-5-one (PubChem CID 14784415) has the molecular formula C5H7NO and a molecular weight of 97.12 g/mol. Its IUPAC name is 4-methyl-1,2-dihydropyrrol-5-one.
| Compound Name | 4-methyl-1,2-dihydropyrrol-5-one |
|---|---|
| PubChem CID | 14784415 |
| Molecular Formula | C5H7NO |
| Molecular Weight | 97.12 g/mol |
| Exact Mass | 97.05 |
| IUPAC Name | 4-methyl-1,2-dihydropyrrol-5-one |
| SMILES | CC1=CCNC1=O |
| InChI | InChI=1S/C5H7NO/c1-4-2-3-6-5(4)7/h2H,3H2,1H3,(H,6,7) |
| InChIKey | FKGZOXIZGQWMTF-UHFFFAOYSA-N |
| XLogP | 0.06 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 97.12 |
| LogP ≤ 5 | 0.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |