C15H12ClN5O2 — CID 147844385
4-[5-chloro-2-[(1-methylpyrazol-4-yl)amino]pyrimidin-4-yl]benzoic acid (PubChem CID 147844385) has the molecular formula C15H12ClN5O2 and a molecular weight of 329.75 g/mol. Its IUPAC name is 4-[5-chloro-2-[(1-methylpyrazol-4-yl)amino]pyrimidin-4-yl]benzoic acid.
| Compound Name | 4-[5-chloro-2-[(1-methylpyrazol-4-yl)amino]pyrimidin-4-yl]benzoic acid |
|---|---|
| PubChem CID | 147844385 |
| Molecular Formula | C15H12ClN5O2 |
| Molecular Weight | 329.75 g/mol |
| Exact Mass | 329.07 |
| IUPAC Name | 4-[5-chloro-2-[(1-methylpyrazol-4-yl)amino]pyrimidin-4-yl]benzoic acid |
| SMILES | Cn1cc(Nc2ncc(Cl)c(-c3ccc(C(=O)O)cc3)n2)cn1 |
| InChI | InChI=1S/C15H12ClN5O2/c1-21-8-11(6-18-21)19-15-17-7-12(16)13(20-15)9-2-4-10(5-3-9)14(22)23/h2-8H,1H3,(H,22,23)(H,17,19,20) |
| InChIKey | HTPHSCWMXIKWIJ-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 92.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.75 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |