C25H34F3N9 — CID 147845192
6-(4-methylpiperazin-1-yl)-2-N-[4-methyl-5-[(3Z,5E)-7,7,7-trifluorohepta-3,5-dien-2-yl]pyrazolidin-3-yl]-4-N-phenyl-1,3,5-triazine-2,4-diamine (PubChem CID 147845192) has the molecular formula C25H34F3N9 and a molecular weight of 517.60 g/mol. Its IUPAC name is 6-(4-methylpiperazin-1-yl)-2-N-[4-methyl-5-[(3Z,5E)-7,7,7-trifluorohepta-3,5-dien-2-yl]pyrazolidin-3-yl]-4-N-phenyl-1,3,5-triazine-2,4-diamine.
| Compound Name | 6-(4-methylpiperazin-1-yl)-2-N-[4-methyl-5-[(3Z,5E)-7,7,7-trifluorohepta-3,5-dien-2-yl]pyrazolidin-3-yl]-4-N-phenyl-1,3,5-triazine-2,4-diamine |
|---|---|
| PubChem CID | 147845192 |
| Molecular Formula | C25H34F3N9 |
| Molecular Weight | 517.60 g/mol |
| Exact Mass | 517.29 |
| IUPAC Name | 6-(4-methylpiperazin-1-yl)-2-N-[4-methyl-5-[(3Z,5E)-7,7,7-trifluorohepta-3,5-dien-2-yl]pyrazolidin-3-yl]-4-N-phenyl-1,3,5-triazine-2,4-diamine |
| SMILES | CC(/C=C\C=C\C(F)(F)F)C1NNC(Nc2nc(Nc3ccccc3)nc(N3CCN(C)CC3)n2)C1C |
| InChI | InChI=1S/C25H34F3N9/c1-17(9-7-8-12-25(26,27)28)20-18(2)21(35-34-20)30-23-31-22(29-19-10-5-4-6-11-19)32-24(33-23)37-15-13-36(3)14-16-37/h4-12,17-18,20-21,34-35H,13-16H2,1-3H3,(H2,29,30,31,32,33)/b9-7-,12-8+ |
| InChIKey | HTTFCUJJTJBDGA-ZUQSVMQASA-N |
| XLogP | 3.53 |
| TPSA | 93.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.60 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|