C20H20ClN5O3 — CID 147846816
3-chloro-4-[(8-cyclopentyl-5-methyl-7-methylidene-6-oxopteridin-2-yl)amino]benzoic acid (PubChem CID 147846816) has the molecular formula C20H20ClN5O3 and a molecular weight of 413.87 g/mol. Its IUPAC name is 3-chloro-4-[(8-cyclopentyl-5-methyl-7-methylidene-6-oxopteridin-2-yl)amino]benzoic acid.
| Compound Name | 3-chloro-4-[(8-cyclopentyl-5-methyl-7-methylidene-6-oxopteridin-2-yl)amino]benzoic acid |
|---|---|
| PubChem CID | 147846816 |
| Molecular Formula | C20H20ClN5O3 |
| Molecular Weight | 413.87 g/mol |
| Exact Mass | 413.13 |
| IUPAC Name | 3-chloro-4-[(8-cyclopentyl-5-methyl-7-methylidene-6-oxopteridin-2-yl)amino]benzoic acid |
| SMILES | C=C1C(=O)N(C)c2cnc(Nc3ccc(C(=O)O)cc3Cl)nc2N1C1CCCC1 |
| InChI | InChI=1S/C20H20ClN5O3/c1-11-18(27)25(2)16-10-22-20(24-17(16)26(11)13-5-3-4-6-13)23-15-8-7-12(19(28)29)9-14(15)21/h7-10,13H,1,3-6H2,2H3,(H,28,29)(H,22,23,24) |
| InChIKey | HUBBIQUTNNVSOF-UHFFFAOYSA-N |
| XLogP | 3.81 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.87 |
| LogP ≤ 5 | 3.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|