About 1-tributylsilylethanone
1-tributylsilylethanone (PubChem CID 14785188) has the molecular formula C14H30OSi
and a molecular weight of 242.48 g/mol. Its IUPAC name is 1-tributylsilylethanone.
Molecular Properties
| Compound Name | 1-tributylsilylethanone |
| PubChem CID | 14785188 |
| Molecular Formula | C14H30OSi |
| Molecular Weight | 242.48 g/mol |
| Exact Mass | 242.21 |
| IUPAC Name | 1-tributylsilylethanone |
| SMILES | CCCC[Si](CCCC)(CCCC)C(C)=O |
| InChI | InChI=1S/C14H30OSi/c1-5-8-11-16(14(4)15,12-9-6-2)13-10-7-3/h5-13H2,1-4H3 |
| InChIKey | CNPOOOIVPPIDEG-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.48 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 1-tributylsilylethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-tributylsilylethanone?
The IUPAC name of 1-tributylsilylethanone (CID 14785188) is 1-tributylsilylethanone.
What is the SMILES notation for 1-tributylsilylethanone?
The canonical SMILES for 1-tributylsilylethanone is CCCC[Si](CCCC)(CCCC)C(C)=O.
What is the InChIKey of 1-tributylsilylethanone?
The InChIKey is CNPOOOIVPPIDEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H30OSi/c1-5-8-11-16(14(4)15,12-9-6-2)13-10-7-3/h5-13H2,1-4H3.
What are the key properties of 1-tributylsilylethanone?
1-tributylsilylethanone has a molecular weight of 242.48 g/mol, XLogP of 4.96, 10 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-tributylsilylethanone is sourced from PubChem (CID 14785188), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).