C19H23BO5S — CID 147855157
4,4,5,5-tetramethyl-2-(5-methylsulfonyl-2-phenoxyphenyl)-1,3,2-dioxaborolane (PubChem CID 147855157) has the molecular formula C19H23BO5S and a molecular weight of 374.27 g/mol. Its IUPAC name is 4,4,5,5-tetramethyl-2-(5-methylsulfonyl-2-phenoxyphenyl)-1,3,2-dioxaborolane.
| Compound Name | 4,4,5,5-tetramethyl-2-(5-methylsulfonyl-2-phenoxyphenyl)-1,3,2-dioxaborolane |
|---|---|
| PubChem CID | 147855157 |
| Molecular Formula | C19H23BO5S |
| Molecular Weight | 374.27 g/mol |
| Exact Mass | 374.14 |
| IUPAC Name | 4,4,5,5-tetramethyl-2-(5-methylsulfonyl-2-phenoxyphenyl)-1,3,2-dioxaborolane |
| SMILES | CC1(C)OB(c2cc(S(C)(=O)=O)ccc2Oc2ccccc2)OC1(C)C |
| InChI | InChI=1S/C19H23BO5S/c1-18(2)19(3,4)25-20(24-18)16-13-15(26(5,21)22)11-12-17(16)23-14-9-7-6-8-10-14/h6-13H,1-5H3 |
| InChIKey | HVOXIFDUKWTPKB-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.27 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|