About 4,5,6-triethylbenzene-1,3-diamine
4,5,6-triethylbenzene-1,3-diamine (PubChem CID 14785533) has the molecular formula C12H20N2
and a molecular weight of 192.31 g/mol. Its IUPAC name is 4,5,6-triethylbenzene-1,3-diamine.
Molecular Properties
| Compound Name | 4,5,6-triethylbenzene-1,3-diamine |
| PubChem CID | 14785533 |
| Molecular Formula | C12H20N2 |
| Molecular Weight | 192.31 g/mol |
| Exact Mass | 192.16 |
| IUPAC Name | 4,5,6-triethylbenzene-1,3-diamine |
| SMILES | CCc1c(N)cc(N)c(CC)c1CC |
| InChI | InChI=1S/C12H20N2/c1-4-8-9(5-2)11(13)7-12(14)10(8)6-3/h7H,4-6,13-14H2,1-3H3 |
| InChIKey | LNDGBGBCACPQCX-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.31 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 4,5,6-triethylbenzene-1,3-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5,6-triethylbenzene-1,3-diamine?
The IUPAC name of 4,5,6-triethylbenzene-1,3-diamine (CID 14785533) is 4,5,6-triethylbenzene-1,3-diamine.
What is the SMILES notation for 4,5,6-triethylbenzene-1,3-diamine?
The canonical SMILES for 4,5,6-triethylbenzene-1,3-diamine is CCc1c(N)cc(N)c(CC)c1CC.
What is the InChIKey of 4,5,6-triethylbenzene-1,3-diamine?
The InChIKey is LNDGBGBCACPQCX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20N2/c1-4-8-9(5-2)11(13)7-12(14)10(8)6-3/h7H,4-6,13-14H2,1-3H3.
What are the key properties of 4,5,6-triethylbenzene-1,3-diamine?
4,5,6-triethylbenzene-1,3-diamine has a molecular weight of 192.31 g/mol, XLogP of 2.54, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5,6-triethylbenzene-1,3-diamine is sourced from PubChem (CID 14785533), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).