About (4-ethylidenecyclohexa-2,5-dien-1-ylidene)-methyloxidanium
(4-ethylidenecyclohexa-2,5-dien-1-ylidene)-methyloxidanium (PubChem CID 14785545) has the molecular formula C9H11O+
and a molecular weight of 135.19 g/mol. Its IUPAC name is (4-ethylidenecyclohexa-2,5-dien-1-ylidene)-methyloxidanium.
Molecular Properties
| Compound Name | (4-ethylidenecyclohexa-2,5-dien-1-ylidene)-methyloxidanium |
| PubChem CID | 14785545 |
| Molecular Formula | C9H11O+ |
| Molecular Weight | 135.19 g/mol |
| Exact Mass | 135.08 |
| IUPAC Name | (4-ethylidenecyclohexa-2,5-dien-1-ylidene)-methyloxidanium |
| SMILES | CC=C1C=CC(=[O+]C)C=C1 |
| InChI | InChI=1S/C9H11O/c1-3-8-4-6-9(10-2)7-5-8/h3-7H,1-2H3/q+1 |
| InChIKey | MGHXVCCKFZAJRK-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 11.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 135.19 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze (4-ethylidenecyclohexa-2,5-dien-1-ylidene)-methyloxidanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4-ethylidenecyclohexa-2,5-dien-1-ylidene)-methyloxidanium?
The IUPAC name of (4-ethylidenecyclohexa-2,5-dien-1-ylidene)-methyloxidanium (CID 14785545) is (4-ethylidenecyclohexa-2,5-dien-1-ylidene)-methyloxidanium.
What is the SMILES notation for (4-ethylidenecyclohexa-2,5-dien-1-ylidene)-methyloxidanium?
The canonical SMILES for (4-ethylidenecyclohexa-2,5-dien-1-ylidene)-methyloxidanium is CC=C1C=CC(=[O+]C)C=C1.
What is the InChIKey of (4-ethylidenecyclohexa-2,5-dien-1-ylidene)-methyloxidanium?
The InChIKey is MGHXVCCKFZAJRK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11O/c1-3-8-4-6-9(10-2)7-5-8/h3-7H,1-2H3/q+1.
What are the key properties of (4-ethylidenecyclohexa-2,5-dien-1-ylidene)-methyloxidanium?
(4-ethylidenecyclohexa-2,5-dien-1-ylidene)-methyloxidanium has a molecular weight of 135.19 g/mol, XLogP of 1.79, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (4-ethylidenecyclohexa-2,5-dien-1-ylidene)-methyloxidanium is sourced from PubChem (CID 14785545), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).