C26H33NO2 — CID 147859136
[(1R,3S)-1-amino-3-[(6R)-6-[2-(2-ethenoxyphenyl)ethyl]-5,6,7,8-tetrahydronaphthalen-2-yl]cyclopentyl]methanol (PubChem CID 147859136) has the molecular formula C26H33NO2 and a molecular weight of 391.56 g/mol. Its IUPAC name is [(1R,3S)-1-amino-3-[(6R)-6-[2-(2-ethenoxyphenyl)ethyl]-5,6,7,8-tetrahydronaphthalen-2-yl]cyclopentyl]methanol.
| Compound Name | [(1R,3S)-1-amino-3-[(6R)-6-[2-(2-ethenoxyphenyl)ethyl]-5,6,7,8-tetrahydronaphthalen-2-yl]cyclopentyl]methanol |
|---|---|
| PubChem CID | 147859136 |
| Molecular Formula | C26H33NO2 |
| Molecular Weight | 391.56 g/mol |
| Exact Mass | 391.25 |
| IUPAC Name | [(1R,3S)-1-amino-3-[(6R)-6-[2-(2-ethenoxyphenyl)ethyl]-5,6,7,8-tetrahydronaphthalen-2-yl]cyclopentyl]methanol |
| SMILES | C=COc1ccccc1CC[C@H]1CCc2cc([C@H]3CC[C@](N)(CO)C3)ccc2C1 |
| InChI | InChI=1S/C26H33NO2/c1-2-29-25-6-4-3-5-20(25)9-7-19-8-10-22-16-23(12-11-21(22)15-19)24-13-14-26(27,17-24)18-28/h2-6,11-12,16,19,24,28H,1,7-10,13-15,17-18,27H2/t19-,24-,26+/m0/s1 |
| InChIKey | HWIGETQPNIYKDT-VFHOHQAYSA-N |
| XLogP | 4.90 |
| TPSA | 55.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.56 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|