C32H36FN3O8 — CID 147861187
2-prop-2-ynylpent-4-ynoxycarbonyloxymethyl 1-cyclopropyl-6-fluoro-7-[4-[(2-methylpropan-2-yl)oxycarbonyl]piperazin-1-yl]-4-oxoquinoline-3-carboxylate (PubChem CID 147861187) has the molecular formula C32H36FN3O8 and a molecular weight of 609.65 g/mol. Its IUPAC name is 2-prop-2-ynylpent-4-ynoxycarbonyloxymethyl 1-cyclopropyl-6-fluoro-7-[4-[(2-methylpropan-2-yl)oxycarbonyl]piperazin-1-yl]-4-oxoquinoline-3-carboxylate.
| Compound Name | 2-prop-2-ynylpent-4-ynoxycarbonyloxymethyl 1-cyclopropyl-6-fluoro-7-[4-[(2-methylpropan-2-yl)oxycarbonyl]piperazin-1-yl]-4-oxoquinoline-3-carboxylate |
|---|---|
| PubChem CID | 147861187 |
| Molecular Formula | C32H36FN3O8 |
| Molecular Weight | 609.65 g/mol |
| Exact Mass | 609.25 |
| IUPAC Name | 2-prop-2-ynylpent-4-ynoxycarbonyloxymethyl 1-cyclopropyl-6-fluoro-7-[4-[(2-methylpropan-2-yl)oxycarbonyl]piperazin-1-yl]-4-oxoquinoline-3-carboxylate |
| SMILES | C#CCC(CC#C)COC(=O)OCOC(=O)c1cn(C2CC2)c2cc(N3CCN(C(=O)OC(C)(C)C)CC3)c(F)cc2c1=O |
| InChI | InChI=1S/C32H36FN3O8/c1-6-8-21(9-7-2)19-41-31(40)43-20-42-29(38)24-18-36(22-10-11-22)26-17-27(25(33)16-23(26)28(24)37)34-12-14-35(15-13-34)30(39)44-32(3,4)5/h1-2,16-18,21-22H,8-15,19-20H2,3-5H3 |
| InChIKey | HWSUXWNLGULLKH-UHFFFAOYSA-N |
| XLogP | 4.46 |
| TPSA | 116.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.65 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|