C11H14Cl2O4 — CID 14786232
(5R)-2,5-dichloro-3,4,4-trimethoxy-5-prop-2-enylcyclopent-2-en-1-one (PubChem CID 14786232) has the molecular formula C11H14Cl2O4 and a molecular weight of 281.13 g/mol. Its IUPAC name is (5R)-2,5-dichloro-3,4,4-trimethoxy-5-prop-2-enylcyclopent-2-en-1-one.
| Compound Name | (5R)-2,5-dichloro-3,4,4-trimethoxy-5-prop-2-enylcyclopent-2-en-1-one |
|---|---|
| PubChem CID | 14786232 |
| Molecular Formula | C11H14Cl2O4 |
| Molecular Weight | 281.13 g/mol |
| Exact Mass | 280.03 |
| IUPAC Name | (5R)-2,5-dichloro-3,4,4-trimethoxy-5-prop-2-enylcyclopent-2-en-1-one |
| SMILES | C=CC[C@@]1(Cl)C(=O)C(Cl)=C(OC)C1(OC)OC |
| InChI | InChI=1S/C11H14Cl2O4/c1-5-6-10(13)8(14)7(12)9(15-2)11(10,16-3)17-4/h5H,1,6H2,2-4H3/t10-/m1/s1 |
| InChIKey | RXKPSBJXSGTKON-SNVBAGLBSA-N |
| XLogP | 2.21 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.13 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_one_hal(17)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|