C16H23F4NO — CID 147862738
(7S)-7-(6-fluorocyclohexa-1,5-dien-1-yl)-8-(2,2,2-trifluoroethylamino)octan-2-one (PubChem CID 147862738) has the molecular formula C16H23F4NO and a molecular weight of 321.36 g/mol. Its IUPAC name is (7S)-7-(6-fluorocyclohexa-1,5-dien-1-yl)-8-(2,2,2-trifluoroethylamino)octan-2-one.
| Compound Name | (7S)-7-(6-fluorocyclohexa-1,5-dien-1-yl)-8-(2,2,2-trifluoroethylamino)octan-2-one |
|---|---|
| PubChem CID | 147862738 |
| Molecular Formula | C16H23F4NO |
| Molecular Weight | 321.36 g/mol |
| Exact Mass | 321.17 |
| IUPAC Name | (7S)-7-(6-fluorocyclohexa-1,5-dien-1-yl)-8-(2,2,2-trifluoroethylamino)octan-2-one |
| SMILES | CC(=O)CCCC[C@H](CNCC(F)(F)F)C1=CCCC=C1F |
| InChI | InChI=1S/C16H23F4NO/c1-12(22)6-2-3-7-13(10-21-11-16(18,19)20)14-8-4-5-9-15(14)17/h8-9,13,21H,2-7,10-11H2,1H3/t13-/m1/s1 |
| InChIKey | HXAIKLQBNGNOKI-CYBMUJFWSA-N |
| XLogP | 4.48 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.36 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|