C14H12F3N3O2S — CID 1478629
1-methyl-5-[(2-methylphenyl)methylsulfonyl]-3-(trifluoromethyl)pyrazole-4-carbonitrile (PubChem CID 1478629) has the molecular formula C14H12F3N3O2S and a molecular weight of 343.33 g/mol. Its IUPAC name is 1-methyl-5-[(2-methylphenyl)methylsulfonyl]-3-(trifluoromethyl)pyrazole-4-carbonitrile.
| Compound Name | 1-methyl-5-[(2-methylphenyl)methylsulfonyl]-3-(trifluoromethyl)pyrazole-4-carbonitrile |
|---|---|
| PubChem CID | 1478629 |
| Molecular Formula | C14H12F3N3O2S |
| Molecular Weight | 343.33 g/mol |
| Exact Mass | 343.06 |
| IUPAC Name | 1-methyl-5-[(2-methylphenyl)methylsulfonyl]-3-(trifluoromethyl)pyrazole-4-carbonitrile |
| SMILES | Cc1ccccc1CS(=O)(=O)c1c(C#N)c(C(F)(F)F)nn1C |
| InChI | InChI=1S/C14H12F3N3O2S/c1-9-5-3-4-6-10(9)8-23(21,22)13-11(7-18)12(14(15,16)17)19-20(13)2/h3-6H,8H2,1-2H3 |
| InChIKey | KAJOJVFXTPGOKX-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 75.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.33 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |