About N-(2-hydroxyethyl)-N',N'-dimethylprop-2-enehydrazide
N-(2-hydroxyethyl)-N',N'-dimethylprop-2-enehydrazide (PubChem CID 147868698) has the molecular formula C7H14N2O2
and a molecular weight of 158.20 g/mol. Its IUPAC name is N-(2-hydroxyethyl)-N',N'-dimethylprop-2-enehydrazide.
Molecular Properties
| Compound Name | N-(2-hydroxyethyl)-N',N'-dimethylprop-2-enehydrazide |
| PubChem CID | 147868698 |
| Molecular Formula | C7H14N2O2 |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.11 |
| IUPAC Name | N-(2-hydroxyethyl)-N',N'-dimethylprop-2-enehydrazide |
| SMILES | C=CC(=O)N(CCO)N(C)C |
| InChI | InChI=1S/C7H14N2O2/c1-4-7(11)9(5-6-10)8(2)3/h4,10H,1,5-6H2,2-3H3 |
| InChIKey | HYEJETNHQHLFMH-UHFFFAOYSA-N |
| XLogP | -0.53 |
| TPSA | 43.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | -0.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-(2-hydroxyethyl)-N',N'-dimethylprop-2-enehydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-hydroxyethyl)-N',N'-dimethylprop-2-enehydrazide?
The IUPAC name of N-(2-hydroxyethyl)-N',N'-dimethylprop-2-enehydrazide (CID 147868698) is N-(2-hydroxyethyl)-N',N'-dimethylprop-2-enehydrazide.
What is the SMILES notation for N-(2-hydroxyethyl)-N',N'-dimethylprop-2-enehydrazide?
The canonical SMILES for N-(2-hydroxyethyl)-N',N'-dimethylprop-2-enehydrazide is C=CC(=O)N(CCO)N(C)C.
What is the InChIKey of N-(2-hydroxyethyl)-N',N'-dimethylprop-2-enehydrazide?
The InChIKey is HYEJETNHQHLFMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14N2O2/c1-4-7(11)9(5-6-10)8(2)3/h4,10H,1,5-6H2,2-3H3.
What are the key properties of N-(2-hydroxyethyl)-N',N'-dimethylprop-2-enehydrazide?
N-(2-hydroxyethyl)-N',N'-dimethylprop-2-enehydrazide has a molecular weight of 158.20 g/mol, XLogP of -0.53, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-hydroxyethyl)-N',N'-dimethylprop-2-enehydrazide is sourced from PubChem (CID 147868698), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).