About methyl (5Z)-12-oxo-11-oxatricyclo[8.2.2.02,9]tetradeca-5,13-diene-14-carboxylate
methyl (5Z)-12-oxo-11-oxatricyclo[8.2.2.02,9]tetradeca-5,13-diene-14-carboxylate (PubChem CID 14786941) has the molecular formula C15H18O4
and a molecular weight of 262.30 g/mol. Its IUPAC name is methyl (5Z)-12-oxo-11-oxatricyclo[8.2.2.02,9]tetradeca-5,13-diene-14-carboxylate.
Molecular Properties
| Compound Name | methyl (5Z)-12-oxo-11-oxatricyclo[8.2.2.02,9]tetradeca-5,13-diene-14-carboxylate |
| PubChem CID | 14786941 |
| Molecular Formula | C15H18O4 |
| Molecular Weight | 262.30 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | methyl (5Z)-12-oxo-11-oxatricyclo[8.2.2.02,9]tetradeca-5,13-diene-14-carboxylate |
| SMILES | COC(=O)C1=CC2C(=O)OC1C1CC/C=C\CCC21 |
| InChI | InChI=1S/C15H18O4/c1-18-14(16)12-8-11-9-6-4-2-3-5-7-10(9)13(12)19-15(11)17/h2-3,8-11,13H,4-7H2,1H3/b3-2- |
| InChIKey | OQMNGCUYAKNSQN-IHWYPQMZSA-N |
| XLogP | 2.00 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.30 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze methyl (5Z)-12-oxo-11-oxatricyclo[8.2.2.02,9]tetradeca-5,13-diene-14-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (5Z)-12-oxo-11-oxatricyclo[8.2.2.02,9]tetradeca-5,13-diene-14-carboxylate?
The IUPAC name of methyl (5Z)-12-oxo-11-oxatricyclo[8.2.2.02,9]tetradeca-5,13-diene-14-carboxylate (CID 14786941) is methyl (5Z)-12-oxo-11-oxatricyclo[8.2.2.02,9]tetradeca-5,13-diene-14-carboxylate.
What is the SMILES notation for methyl (5Z)-12-oxo-11-oxatricyclo[8.2.2.02,9]tetradeca-5,13-diene-14-carboxylate?
The canonical SMILES for methyl (5Z)-12-oxo-11-oxatricyclo[8.2.2.02,9]tetradeca-5,13-diene-14-carboxylate is COC(=O)C1=CC2C(=O)OC1C1CC/C=C\CCC21.
What is the InChIKey of methyl (5Z)-12-oxo-11-oxatricyclo[8.2.2.02,9]tetradeca-5,13-diene-14-carboxylate?
The InChIKey is OQMNGCUYAKNSQN-IHWYPQMZSA-N. The full InChI is InChI=1S/C15H18O4/c1-18-14(16)12-8-11-9-6-4-2-3-5-7-10(9)13(12)19-15(11)17/h2-3,8-11,13H,4-7H2,1H3/b3-2-.
What are the key properties of methyl (5Z)-12-oxo-11-oxatricyclo[8.2.2.02,9]tetradeca-5,13-diene-14-carboxylate?
methyl (5Z)-12-oxo-11-oxatricyclo[8.2.2.02,9]tetradeca-5,13-diene-14-carboxylate has a molecular weight of 262.30 g/mol, XLogP of 2.00, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (5Z)-12-oxo-11-oxatricyclo[8.2.2.02,9]tetradeca-5,13-diene-14-carboxylate is sourced from PubChem (CID 14786941), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).