C12H21NO5 — CID 147869647
N-[(2S,3S,4R)-4-hydroxy-6-(hydroxymethyl)-5-methoxy-2-methyloxan-3-yl]-2-methylprop-2-enamide (PubChem CID 147869647) has the molecular formula C12H21NO5 and a molecular weight of 259.30 g/mol. Its IUPAC name is N-[(2S,3S,4R)-4-hydroxy-6-(hydroxymethyl)-5-methoxy-2-methyloxan-3-yl]-2-methylprop-2-enamide.
| Compound Name | N-[(2S,3S,4R)-4-hydroxy-6-(hydroxymethyl)-5-methoxy-2-methyloxan-3-yl]-2-methylprop-2-enamide |
|---|---|
| PubChem CID | 147869647 |
| Molecular Formula | C12H21NO5 |
| Molecular Weight | 259.30 g/mol |
| Exact Mass | 259.14 |
| IUPAC Name | N-[(2S,3S,4R)-4-hydroxy-6-(hydroxymethyl)-5-methoxy-2-methyloxan-3-yl]-2-methylprop-2-enamide |
| SMILES | C=C(C)C(=O)N[C@@H]1[C@H](C)OC(CO)C(OC)[C@@H]1O |
| InChI | InChI=1S/C12H21NO5/c1-6(2)12(16)13-9-7(3)18-8(5-14)11(17-4)10(9)15/h7-11,14-15H,1,5H2,2-4H3,(H,13,16)/t7-,8?,9+,10+,11?/m0/s1 |
| InChIKey | HYJCUAKYWSHVOT-YJPZDHHCSA-N |
| XLogP | -0.80 |
| TPSA | 88.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.30 |
| LogP ≤ 5 | -0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|