About 5,6-dihydrofuro[2,3-h]quinazolin-2-amine
5,6-dihydrofuro[2,3-h]quinazolin-2-amine (PubChem CID 1478697) has the molecular formula C10H9N3O
and a molecular weight of 187.20 g/mol. Its IUPAC name is 5,6-dihydrofuro[2,3-h]quinazolin-2-amine.
Molecular Properties
| Compound Name | 5,6-dihydrofuro[2,3-h]quinazolin-2-amine |
| PubChem CID | 1478697 |
| Molecular Formula | C10H9N3O |
| Molecular Weight | 187.20 g/mol |
| Exact Mass | 187.07 |
| IUPAC Name | 5,6-dihydrofuro[2,3-h]quinazolin-2-amine |
| SMILES | Nc1ncc2c(n1)-c1ccoc1CC2 |
| InChI | InChI=1S/C10H9N3O/c11-10-12-5-6-1-2-8-7(3-4-14-8)9(6)13-10/h3-5H,1-2H2,(H2,11,12,13) |
| InChIKey | CMVSERWVNYLVGI-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 187.20 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5,6-dihydrofuro[2,3-h]quinazolin-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-dihydrofuro[2,3-h]quinazolin-2-amine?
The IUPAC name of 5,6-dihydrofuro[2,3-h]quinazolin-2-amine (CID 1478697) is 5,6-dihydrofuro[2,3-h]quinazolin-2-amine.
What is the SMILES notation for 5,6-dihydrofuro[2,3-h]quinazolin-2-amine?
The canonical SMILES for 5,6-dihydrofuro[2,3-h]quinazolin-2-amine is Nc1ncc2c(n1)-c1ccoc1CC2.
What is the InChIKey of 5,6-dihydrofuro[2,3-h]quinazolin-2-amine?
The InChIKey is CMVSERWVNYLVGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9N3O/c11-10-12-5-6-1-2-8-7(3-4-14-8)9(6)13-10/h3-5H,1-2H2,(H2,11,12,13).
What are the key properties of 5,6-dihydrofuro[2,3-h]quinazolin-2-amine?
5,6-dihydrofuro[2,3-h]quinazolin-2-amine has a molecular weight of 187.20 g/mol, XLogP of 1.42, 0 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-dihydrofuro[2,3-h]quinazolin-2-amine is sourced from PubChem (CID 1478697), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).