C15H17NO3 — CID 14787207
4-hexanoyl-2-phenyl-4H-1,3-oxazol-5-one (PubChem CID 14787207) has the molecular formula C15H17NO3 and a molecular weight of 259.31 g/mol. Its IUPAC name is 4-hexanoyl-2-phenyl-4H-1,3-oxazol-5-one.
| Compound Name | 4-hexanoyl-2-phenyl-4H-1,3-oxazol-5-one |
|---|---|
| PubChem CID | 14787207 |
| Molecular Formula | C15H17NO3 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.12 |
| IUPAC Name | 4-hexanoyl-2-phenyl-4H-1,3-oxazol-5-one |
| SMILES | CCCCCC(=O)C1N=C(c2ccccc2)OC1=O |
| InChI | InChI=1S/C15H17NO3/c1-2-3-5-10-12(17)13-15(18)19-14(16-13)11-8-6-4-7-9-11/h4,6-9,13H,2-3,5,10H2,1H3 |
| InChIKey | GUIZPLYHZWSEOE-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 55.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|