C29H37O5P — CID 14787683
2,2,2-tris(2,6-dimethylphenoxy)-5,5-dimethyl-1,3,2lambda5-dioxaphosphinane (PubChem CID 14787683) has the molecular formula C29H37O5P and a molecular weight of 496.58 g/mol. Its IUPAC name is 2,2,2-tris(2,6-dimethylphenoxy)-5,5-dimethyl-1,3,2lambda5-dioxaphosphinane.
| Compound Name | 2,2,2-tris(2,6-dimethylphenoxy)-5,5-dimethyl-1,3,2lambda5-dioxaphosphinane |
|---|---|
| PubChem CID | 14787683 |
| Molecular Formula | C29H37O5P |
| Molecular Weight | 496.58 g/mol |
| Exact Mass | 496.24 |
| IUPAC Name | 2,2,2-tris(2,6-dimethylphenoxy)-5,5-dimethyl-1,3,2lambda5-dioxaphosphinane |
| SMILES | Cc1cccc(C)c1OP1(Oc2c(C)cccc2C)(Oc2c(C)cccc2C)OCC(C)(C)CO1 |
| InChI | InChI=1S/C29H37O5P/c1-20-12-9-13-21(2)26(20)32-35(30-18-29(7,8)19-31-35,33-27-22(3)14-10-15-23(27)4)34-28-24(5)16-11-17-25(28)6/h9-17H,18-19H2,1-8H3 |
| InChIKey | LRJRMCABVRCZPH-UHFFFAOYSA-N |
| XLogP | 8.28 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.58 |
| LogP ≤ 5 | 8.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|