C20H24ClN3O5S — CID 147877003
1-(4-chloro-2-hydroxy-3-piperidin-4-ylsulfonylphenyl)-3-[(7S)-4,5,6,7-tetrahydro-1-benzofuran-7-yl]urea (PubChem CID 147877003) has the molecular formula C20H24ClN3O5S and a molecular weight of 453.95 g/mol. Its IUPAC name is 1-(4-chloro-2-hydroxy-3-piperidin-4-ylsulfonylphenyl)-3-[(7S)-4,5,6,7-tetrahydro-1-benzofuran-7-yl]urea.
| Compound Name | 1-(4-chloro-2-hydroxy-3-piperidin-4-ylsulfonylphenyl)-3-[(7S)-4,5,6,7-tetrahydro-1-benzofuran-7-yl]urea |
|---|---|
| PubChem CID | 147877003 |
| Molecular Formula | C20H24ClN3O5S |
| Molecular Weight | 453.95 g/mol |
| Exact Mass | 453.11 |
| IUPAC Name | 1-(4-chloro-2-hydroxy-3-piperidin-4-ylsulfonylphenyl)-3-[(7S)-4,5,6,7-tetrahydro-1-benzofuran-7-yl]urea |
| SMILES | O=C(Nc1ccc(Cl)c(S(=O)(=O)C2CCNCC2)c1O)N[C@H]1CCCc2ccoc21 |
| InChI | InChI=1S/C20H24ClN3O5S/c21-14-4-5-15(17(25)19(14)30(27,28)13-6-9-22-10-7-13)23-20(26)24-16-3-1-2-12-8-11-29-18(12)16/h4-5,8,11,13,16,22,25H,1-3,6-7,9-10H2,(H2,23,24,26)/t16-/m0/s1 |
| InChIKey | HZSGYBWSBHJWIZ-INIZCTEOSA-N |
| XLogP | 3.36 |
| TPSA | 120.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.95 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|