About 4,5-ditert-butylpyridazine
4,5-ditert-butylpyridazine (PubChem CID 14787710) has the molecular formula C12H20N2
and a molecular weight of 192.31 g/mol. Its IUPAC name is 4,5-ditert-butylpyridazine.
Molecular Properties
| Compound Name | 4,5-ditert-butylpyridazine |
| PubChem CID | 14787710 |
| Molecular Formula | C12H20N2 |
| Molecular Weight | 192.31 g/mol |
| Exact Mass | 192.16 |
| IUPAC Name | 4,5-ditert-butylpyridazine |
| SMILES | CC(C)(C)c1cnncc1C(C)(C)C |
| InChI | InChI=1S/C12H20N2/c1-11(2,3)9-7-13-14-8-10(9)12(4,5)6/h7-8H,1-6H3 |
| InChIKey | POMQIBSXIHJREU-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.31 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4,5-ditert-butylpyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,5-ditert-butylpyridazine?
The IUPAC name of 4,5-ditert-butylpyridazine (CID 14787710) is 4,5-ditert-butylpyridazine.
What is the SMILES notation for 4,5-ditert-butylpyridazine?
The canonical SMILES for 4,5-ditert-butylpyridazine is CC(C)(C)c1cnncc1C(C)(C)C.
What is the InChIKey of 4,5-ditert-butylpyridazine?
The InChIKey is POMQIBSXIHJREU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H20N2/c1-11(2,3)9-7-13-14-8-10(9)12(4,5)6/h7-8H,1-6H3.
What are the key properties of 4,5-ditert-butylpyridazine?
4,5-ditert-butylpyridazine has a molecular weight of 192.31 g/mol, XLogP of 3.07, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-ditert-butylpyridazine is sourced from PubChem (CID 14787710), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).