About 2-benzhydryl-4,4-dicyclopropyloxazetidin-3-one
2-benzhydryl-4,4-dicyclopropyloxazetidin-3-one (PubChem CID 14787845) has the molecular formula C21H21NO2
and a molecular weight of 319.40 g/mol. Its IUPAC name is 2-benzhydryl-4,4-dicyclopropyloxazetidin-3-one.
Molecular Properties
| Compound Name | 2-benzhydryl-4,4-dicyclopropyloxazetidin-3-one |
| PubChem CID | 14787845 |
| Molecular Formula | C21H21NO2 |
| Molecular Weight | 319.40 g/mol |
| Exact Mass | 319.16 |
| IUPAC Name | 2-benzhydryl-4,4-dicyclopropyloxazetidin-3-one |
| SMILES | O=C1N(C(c2ccccc2)c2ccccc2)OC1(C1CC1)C1CC1 |
| InChI | InChI=1S/C21H21NO2/c23-20-21(17-11-12-17,18-13-14-18)24-22(20)19(15-7-3-1-4-8-15)16-9-5-2-6-10-16/h1-10,17-19H,11-14H2 |
| InChIKey | XEDUTHVTZSFSSG-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 319.40 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-benzhydryl-4,4-dicyclopropyloxazetidin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzhydryl-4,4-dicyclopropyloxazetidin-3-one?
The IUPAC name of 2-benzhydryl-4,4-dicyclopropyloxazetidin-3-one (CID 14787845) is 2-benzhydryl-4,4-dicyclopropyloxazetidin-3-one.
What is the SMILES notation for 2-benzhydryl-4,4-dicyclopropyloxazetidin-3-one?
The canonical SMILES for 2-benzhydryl-4,4-dicyclopropyloxazetidin-3-one is O=C1N(C(c2ccccc2)c2ccccc2)OC1(C1CC1)C1CC1.
What is the InChIKey of 2-benzhydryl-4,4-dicyclopropyloxazetidin-3-one?
The InChIKey is XEDUTHVTZSFSSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H21NO2/c23-20-21(17-11-12-17,18-13-14-18)24-22(20)19(15-7-3-1-4-8-15)16-9-5-2-6-10-16/h1-10,17-19H,11-14H2.
What are the key properties of 2-benzhydryl-4,4-dicyclopropyloxazetidin-3-one?
2-benzhydryl-4,4-dicyclopropyloxazetidin-3-one has a molecular weight of 319.40 g/mol, XLogP of 4.11, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzhydryl-4,4-dicyclopropyloxazetidin-3-one is sourced from PubChem (CID 14787845), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).