C33H46ClN3O6S2 — CID 147878460
tert-butyl (E)-3-[10-[2-[2-[2-(6-chlorohexoxy)ethoxy]ethylcarbamoyloxy]ethyl-methylamino]-7,7-dimethyl-3,11-dithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]-2-cyanoprop-2-enoate (PubChem CID 147878460) has the molecular formula C33H46ClN3O6S2 and a molecular weight of 680.33 g/mol. Its IUPAC name is tert-butyl (E)-3-[10-[2-[2-[2-(6-chlorohexoxy)ethoxy]ethylcarbamoyloxy]ethyl-methylamino]-7,7-dimethyl-3,11-dithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]-2-cyanoprop-2-enoate.
| Compound Name | tert-butyl (E)-3-[10-[2-[2-[2-(6-chlorohexoxy)ethoxy]ethylcarbamoyloxy]ethyl-methylamino]-7,7-dimethyl-3,11-dithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]-2-cyanoprop-2-enoate |
|---|---|
| PubChem CID | 147878460 |
| Molecular Formula | C33H46ClN3O6S2 |
| Molecular Weight | 680.33 g/mol |
| Exact Mass | 679.25 |
| IUPAC Name | tert-butyl (E)-3-[10-[2-[2-[2-(6-chlorohexoxy)ethoxy]ethylcarbamoyloxy]ethyl-methylamino]-7,7-dimethyl-3,11-dithiatricyclo[6.3.0.02,6]undeca-1(8),2(6),4,9-tetraen-4-yl]-2-cyanoprop-2-enoate |
| SMILES | CN(CCOC(=O)NCCOCCOCCCCCCCl)c1cc2c(s1)-c1sc(/C=C(\C#N)C(=O)OC(C)(C)C)cc1C2(C)C |
| InChI | InChI=1S/C33H46ClN3O6S2/c1-32(2,3)43-30(38)23(22-35)19-24-20-25-28(44-24)29-26(33(25,4)5)21-27(45-29)37(6)13-16-42-31(39)36-12-15-41-18-17-40-14-10-8-7-9-11-34/h19-21H,7-18H2,1-6H3,(H,36,39)/b23-19+ |
| InChIKey | HZYYHRJBORYDHD-FCDQGJHFSA-N |
| XLogP | 7.36 |
| TPSA | 110.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.33 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|