About 1-O-benzyl 3-O-methyl 6-methoxyindole-1,3-dicarboxylate
1-O-benzyl 3-O-methyl 6-methoxyindole-1,3-dicarboxylate (PubChem CID 14787875) has the molecular formula C19H17NO5
and a molecular weight of 339.35 g/mol. Its IUPAC name is 1-O-benzyl 3-O-methyl 6-methoxyindole-1,3-dicarboxylate.
Molecular Properties
| Compound Name | 1-O-benzyl 3-O-methyl 6-methoxyindole-1,3-dicarboxylate |
| PubChem CID | 14787875 |
| Molecular Formula | C19H17NO5 |
| Molecular Weight | 339.35 g/mol |
| Exact Mass | 339.11 |
| IUPAC Name | 1-O-benzyl 3-O-methyl 6-methoxyindole-1,3-dicarboxylate |
| SMILES | COC(=O)c1cn(C(=O)OCc2ccccc2)c2cc(OC)ccc12 |
| InChI | InChI=1S/C19H17NO5/c1-23-14-8-9-15-16(18(21)24-2)11-20(17(15)10-14)19(22)25-12-13-6-4-3-5-7-13/h3-11H,12H2,1-2H3 |
| InChIKey | SHACEZDXNVJBJJ-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 66.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.35 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-O-benzyl 3-O-methyl 6-methoxyindole-1,3-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-O-benzyl 3-O-methyl 6-methoxyindole-1,3-dicarboxylate?
The IUPAC name of 1-O-benzyl 3-O-methyl 6-methoxyindole-1,3-dicarboxylate (CID 14787875) is 1-O-benzyl 3-O-methyl 6-methoxyindole-1,3-dicarboxylate.
What is the SMILES notation for 1-O-benzyl 3-O-methyl 6-methoxyindole-1,3-dicarboxylate?
The canonical SMILES for 1-O-benzyl 3-O-methyl 6-methoxyindole-1,3-dicarboxylate is COC(=O)c1cn(C(=O)OCc2ccccc2)c2cc(OC)ccc12.
What is the InChIKey of 1-O-benzyl 3-O-methyl 6-methoxyindole-1,3-dicarboxylate?
The InChIKey is SHACEZDXNVJBJJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H17NO5/c1-23-14-8-9-15-16(18(21)24-2)11-20(17(15)10-14)19(22)25-12-13-6-4-3-5-7-13/h3-11H,12H2,1-2H3.
What are the key properties of 1-O-benzyl 3-O-methyl 6-methoxyindole-1,3-dicarboxylate?
1-O-benzyl 3-O-methyl 6-methoxyindole-1,3-dicarboxylate has a molecular weight of 339.35 g/mol, XLogP of 3.62, 4 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-O-benzyl 3-O-methyl 6-methoxyindole-1,3-dicarboxylate is sourced from PubChem (CID 14787875), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).