About ethyl 2-sulfamoyl-3,4-dihydro-1H-isoquinoline-1-carboxylate
ethyl 2-sulfamoyl-3,4-dihydro-1H-isoquinoline-1-carboxylate (PubChem CID 14787908) has the molecular formula C12H16N2O4S
and a molecular weight of 284.34 g/mol. Its IUPAC name is ethyl 2-sulfamoyl-3,4-dihydro-1H-isoquinoline-1-carboxylate.
Molecular Properties
| Compound Name | ethyl 2-sulfamoyl-3,4-dihydro-1H-isoquinoline-1-carboxylate |
| PubChem CID | 14787908 |
| Molecular Formula | C12H16N2O4S |
| Molecular Weight | 284.34 g/mol |
| Exact Mass | 284.08 |
| IUPAC Name | ethyl 2-sulfamoyl-3,4-dihydro-1H-isoquinoline-1-carboxylate |
| SMILES | CCOC(=O)C1c2ccccc2CCN1S(N)(=O)=O |
| InChI | InChI=1S/C12H16N2O4S/c1-2-18-12(15)11-10-6-4-3-5-9(10)7-8-14(11)19(13,16)17/h3-6,11H,2,7-8H2,1H3,(H2,13,16,17) |
| InChIKey | OJPWXXADIWBJOY-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 89.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.34 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze ethyl 2-sulfamoyl-3,4-dihydro-1H-isoquinoline-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-sulfamoyl-3,4-dihydro-1H-isoquinoline-1-carboxylate?
The IUPAC name of ethyl 2-sulfamoyl-3,4-dihydro-1H-isoquinoline-1-carboxylate (CID 14787908) is ethyl 2-sulfamoyl-3,4-dihydro-1H-isoquinoline-1-carboxylate.
What is the SMILES notation for ethyl 2-sulfamoyl-3,4-dihydro-1H-isoquinoline-1-carboxylate?
The canonical SMILES for ethyl 2-sulfamoyl-3,4-dihydro-1H-isoquinoline-1-carboxylate is CCOC(=O)C1c2ccccc2CCN1S(N)(=O)=O.
What is the InChIKey of ethyl 2-sulfamoyl-3,4-dihydro-1H-isoquinoline-1-carboxylate?
The InChIKey is OJPWXXADIWBJOY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16N2O4S/c1-2-18-12(15)11-10-6-4-3-5-9(10)7-8-14(11)19(13,16)17/h3-6,11H,2,7-8H2,1H3,(H2,13,16,17).
What are the key properties of ethyl 2-sulfamoyl-3,4-dihydro-1H-isoquinoline-1-carboxylate?
ethyl 2-sulfamoyl-3,4-dihydro-1H-isoquinoline-1-carboxylate has a molecular weight of 284.34 g/mol, XLogP of 0.35, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-sulfamoyl-3,4-dihydro-1H-isoquinoline-1-carboxylate is sourced from PubChem (CID 14787908), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).