C31H27F4N5O4 — CID 147879530
4-[6-fluoro-10-[4-(2,2,2-trifluoro-1-hydroxyethyl)piperidine-1-carbonyl]-1,10-diazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraen-3-yl]-5-imidazo[1,2-a]pyridin-3-ylcyclopent-4-ene-1,3-dione (PubChem CID 147879530) has the molecular formula C31H27F4N5O4 and a molecular weight of 609.58 g/mol. Its IUPAC name is 4-[6-fluoro-10-[4-(2,2,2-trifluoro-1-hydroxyethyl)piperidine-1-carbonyl]-1,10-diazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraen-3-yl]-5-imidazo[1,2-a]pyridin-3-ylcyclopent-4-ene-1,3-dione.
| Compound Name | 4-[6-fluoro-10-[4-(2,2,2-trifluoro-1-hydroxyethyl)piperidine-1-carbonyl]-1,10-diazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraen-3-yl]-5-imidazo[1,2-a]pyridin-3-ylcyclopent-4-ene-1,3-dione |
|---|---|
| PubChem CID | 147879530 |
| Molecular Formula | C31H27F4N5O4 |
| Molecular Weight | 609.58 g/mol |
| Exact Mass | 609.20 |
| IUPAC Name | 4-[6-fluoro-10-[4-(2,2,2-trifluoro-1-hydroxyethyl)piperidine-1-carbonyl]-1,10-diazatricyclo[6.4.1.04,13]trideca-2,4,6,8(13)-tetraen-3-yl]-5-imidazo[1,2-a]pyridin-3-ylcyclopent-4-ene-1,3-dione |
| SMILES | O=C1CC(=O)C(c2cnc3ccccn23)=C1c1cn2c3c(cc(F)cc13)CN(C(=O)N1CCC(C(O)C(F)(F)F)CC1)CC2 |
| InChI | InChI=1S/C31H27F4N5O4/c32-19-11-18-15-39(30(44)37-7-4-17(5-8-37)29(43)31(33,34)35)10-9-38-16-21(20(12-19)28(18)38)26-23(41)13-24(42)27(26)22-14-36-25-3-1-2-6-40(22)25/h1-3,6,11-12,14,16-17,29,43H,4-5,7-10,13,15H2 |
| InChIKey | IAECLSRODDKHEO-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 100.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.58 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|