C18H19F3N2O4S — CID 14788036
diethyl 6-methyl-2-sulfanylidene-4-[2-(trifluoromethyl)phenyl]-1,4-dihydropyrimidine-3,5-dicarboxylate (PubChem CID 14788036) has the molecular formula C18H19F3N2O4S and a molecular weight of 416.42 g/mol. Its IUPAC name is diethyl 6-methyl-2-sulfanylidene-4-[2-(trifluoromethyl)phenyl]-1,4-dihydropyrimidine-3,5-dicarboxylate.
| Compound Name | diethyl 6-methyl-2-sulfanylidene-4-[2-(trifluoromethyl)phenyl]-1,4-dihydropyrimidine-3,5-dicarboxylate |
|---|---|
| PubChem CID | 14788036 |
| Molecular Formula | C18H19F3N2O4S |
| Molecular Weight | 416.42 g/mol |
| Exact Mass | 416.10 |
| IUPAC Name | diethyl 6-methyl-2-sulfanylidene-4-[2-(trifluoromethyl)phenyl]-1,4-dihydropyrimidine-3,5-dicarboxylate |
| SMILES | CCOC(=O)C1=C(C)NC(=S)N(C(=O)OCC)C1c1ccccc1C(F)(F)F |
| InChI | InChI=1S/C18H19F3N2O4S/c1-4-26-15(24)13-10(3)22-16(28)23(17(25)27-5-2)14(13)11-8-6-7-9-12(11)18(19,20)21/h6-9,14H,4-5H2,1-3H3,(H,22,28) |
| InChIKey | MVDUTUJNRHYLDC-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.42 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|