C19H22F2O3 — CID 147880525
2,2-difluoro-3-[4-[(4-propoxyphenyl)methyl]phenoxy]propan-1-ol (PubChem CID 147880525) has the molecular formula C19H22F2O3 and a molecular weight of 336.38 g/mol. Its IUPAC name is 2,2-difluoro-3-[4-[(4-propoxyphenyl)methyl]phenoxy]propan-1-ol.
| Compound Name | 2,2-difluoro-3-[4-[(4-propoxyphenyl)methyl]phenoxy]propan-1-ol |
|---|---|
| PubChem CID | 147880525 |
| Molecular Formula | C19H22F2O3 |
| Molecular Weight | 336.38 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | 2,2-difluoro-3-[4-[(4-propoxyphenyl)methyl]phenoxy]propan-1-ol |
| SMILES | CCCOc1ccc(Cc2ccc(OCC(F)(F)CO)cc2)cc1 |
| InChI | InChI=1S/C19H22F2O3/c1-2-11-23-17-7-3-15(4-8-17)12-16-5-9-18(10-6-16)24-14-19(20,21)13-22/h3-10,22H,2,11-14H2,1H3 |
| InChIKey | WMUYZSYFURSFKT-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.38 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |