C23H26F3N3O4 — CID 147885663
[(E)-2-(4-tert-butylphenyl)-2-cyano-1-(2-ethyl-5-methylpyrazol-3-yl)ethenoxy]methyl 2,2,2-trifluoroethyl carbonate (PubChem CID 147885663) has the molecular formula C23H26F3N3O4 and a molecular weight of 465.47 g/mol. Its IUPAC name is [(E)-2-(4-tert-butylphenyl)-2-cyano-1-(2-ethyl-5-methylpyrazol-3-yl)ethenoxy]methyl 2,2,2-trifluoroethyl carbonate.
| Compound Name | [(E)-2-(4-tert-butylphenyl)-2-cyano-1-(2-ethyl-5-methylpyrazol-3-yl)ethenoxy]methyl 2,2,2-trifluoroethyl carbonate |
|---|---|
| PubChem CID | 147885663 |
| Molecular Formula | C23H26F3N3O4 |
| Molecular Weight | 465.47 g/mol |
| Exact Mass | 465.19 |
| IUPAC Name | [(E)-2-(4-tert-butylphenyl)-2-cyano-1-(2-ethyl-5-methylpyrazol-3-yl)ethenoxy]methyl 2,2,2-trifluoroethyl carbonate |
| SMILES | CCn1nc(C)cc1/C(OCOC(=O)OCC(F)(F)F)=C(\C#N)c1ccc(C(C)(C)C)cc1 |
| InChI | InChI=1S/C23H26F3N3O4/c1-6-29-19(11-15(2)28-29)20(32-14-33-21(30)31-13-23(24,25)26)18(12-27)16-7-9-17(10-8-16)22(3,4)5/h7-11H,6,13-14H2,1-5H3/b20-18- |
| InChIKey | IBGZEVDAEJKYOF-ZZEZOPTASA-N |
| XLogP | 5.59 |
| TPSA | 86.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.47 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|