C31H22F5N5O2 — CID 147887958
5-[2-[(2R)-5-(9-cyano-5,5-difluoro-7,8-diazatricyclo[4.3.0.02,4]nona-1(6),8-dien-7-yl)-1-(3,5-difluorophenyl)-4-oxopentan-2-yl]-3-pyridinyl]-2-fluorobenzamide (PubChem CID 147887958) has the molecular formula C31H22F5N5O2 and a molecular weight of 591.54 g/mol. Its IUPAC name is 5-[2-[(2R)-5-(9-cyano-5,5-difluoro-7,8-diazatricyclo[4.3.0.02,4]nona-1(6),8-dien-7-yl)-1-(3,5-difluorophenyl)-4-oxopentan-2-yl]-3-pyridinyl]-2-fluorobenzamide.
| Compound Name | 5-[2-[(2R)-5-(9-cyano-5,5-difluoro-7,8-diazatricyclo[4.3.0.02,4]nona-1(6),8-dien-7-yl)-1-(3,5-difluorophenyl)-4-oxopentan-2-yl]-3-pyridinyl]-2-fluorobenzamide |
|---|---|
| PubChem CID | 147887958 |
| Molecular Formula | C31H22F5N5O2 |
| Molecular Weight | 591.54 g/mol |
| Exact Mass | 591.17 |
| IUPAC Name | 5-[2-[(2R)-5-(9-cyano-5,5-difluoro-7,8-diazatricyclo[4.3.0.02,4]nona-1(6),8-dien-7-yl)-1-(3,5-difluorophenyl)-4-oxopentan-2-yl]-3-pyridinyl]-2-fluorobenzamide |
| SMILES | N#Cc1nn(CC(=O)C[C@@H](Cc2cc(F)cc(F)c2)c2ncccc2-c2ccc(F)c(C(N)=O)c2)c2c1C1CC1C2(F)F |
| InChI | InChI=1S/C31H22F5N5O2/c32-18-7-15(8-19(33)11-18)6-17(28-21(2-1-5-39-28)16-3-4-25(34)23(10-16)30(38)43)9-20(42)14-41-29-27(26(13-37)40-41)22-12-24(22)31(29,35)36/h1-5,7-8,10-11,17,22,24H,6,9,12,14H2,(H2,38,43)/t17-,22?,24?/m1/s1 |
| InChIKey | IBRYCQXALHVDNO-CVOKNGKCSA-N |
| XLogP | 5.53 |
| TPSA | 114.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.54 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |