C21H26ClN7OS3 — CID 147895243
(5S)-5-[3-chloro-7-[4-(3-methyl-1,2,4-thiadiazol-5-yl)piperidin-1-yl]thieno[2,3-c]pyridin-2-yl]-2,5-dimethyl-1-methylidene-1-oxo-6H-1,2,4-thiadiazin-3-amine (PubChem CID 147895243) has the molecular formula C21H26ClN7OS3 and a molecular weight of 524.14 g/mol. Its IUPAC name is (5S)-5-[3-chloro-7-[4-(3-methyl-1,2,4-thiadiazol-5-yl)piperidin-1-yl]thieno[2,3-c]pyridin-2-yl]-2,5-dimethyl-1-methylidene-1-oxo-6H-1,2,4-thiadiazin-3-amine.
| Compound Name | (5S)-5-[3-chloro-7-[4-(3-methyl-1,2,4-thiadiazol-5-yl)piperidin-1-yl]thieno[2,3-c]pyridin-2-yl]-2,5-dimethyl-1-methylidene-1-oxo-6H-1,2,4-thiadiazin-3-amine |
|---|---|
| PubChem CID | 147895243 |
| Molecular Formula | C21H26ClN7OS3 |
| Molecular Weight | 524.14 g/mol |
| Exact Mass | 523.10 |
| IUPAC Name | (5S)-5-[3-chloro-7-[4-(3-methyl-1,2,4-thiadiazol-5-yl)piperidin-1-yl]thieno[2,3-c]pyridin-2-yl]-2,5-dimethyl-1-methylidene-1-oxo-6H-1,2,4-thiadiazin-3-amine |
| SMILES | C=S1(=O)C[C@@](C)(c2sc3c(N4CCC(c5nc(C)ns5)CC4)nccc3c2Cl)N=C(N)N1C |
| InChI | InChI=1S/C21H26ClN7OS3/c1-12-25-19(32-27-12)13-6-9-29(10-7-13)18-16-14(5-8-24-18)15(22)17(31-16)21(2)11-33(4,30)28(3)20(23)26-21/h5,8,13H,4,6-7,9-11H2,1-3H3,(H2,23,26)/t21-,33?/m0/s1 |
| InChIKey | IDECORCMUUUAPJ-KEDGCLKXSA-N |
| XLogP | 3.60 |
| TPSA | 100.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.14 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|