C10H13F3S — CID 147896476
(3Z,5E)-2,3-dimethyl-6-(trifluoromethylsulfanyl)hepta-1,3,5-triene (PubChem CID 147896476) has the molecular formula C10H13F3S and a molecular weight of 222.27 g/mol. Its IUPAC name is (3Z,5E)-2,3-dimethyl-6-(trifluoromethylsulfanyl)hepta-1,3,5-triene.
| Compound Name | (3Z,5E)-2,3-dimethyl-6-(trifluoromethylsulfanyl)hepta-1,3,5-triene |
|---|---|
| PubChem CID | 147896476 |
| Molecular Formula | C10H13F3S |
| Molecular Weight | 222.27 g/mol |
| Exact Mass | 222.07 |
| IUPAC Name | (3Z,5E)-2,3-dimethyl-6-(trifluoromethylsulfanyl)hepta-1,3,5-triene |
| SMILES | C=C(C)/C(C)=C\C=C(/C)SC(F)(F)F |
| InChI | InChI=1S/C10H13F3S/c1-7(2)8(3)5-6-9(4)14-10(11,12)13/h5-6H,1H2,2-4H3/b8-5-,9-6+ |
| InChIKey | IDJYFDLRNKLMGG-LDFAFZTOSA-N |
| XLogP | 4.67 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.27 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|