About (Z)-3,4-dimethylhex-3-en-2-imine
(Z)-3,4-dimethylhex-3-en-2-imine (PubChem CID 147896973) has the molecular formula C8H15N
and a molecular weight of 125.21 g/mol. Its IUPAC name is (Z)-3,4-dimethylhex-3-en-2-imine.
Molecular Properties
| Compound Name | (Z)-3,4-dimethylhex-3-en-2-imine |
| PubChem CID | 147896973 |
| Molecular Formula | C8H15N |
| Molecular Weight | 125.21 g/mol |
| Exact Mass | 125.12 |
| IUPAC Name | (Z)-3,4-dimethylhex-3-en-2-imine |
| SMILES | [H]/N=C(C)/C(C)=C(/C)CC |
| InChI | InChI=1S/C8H15N/c1-5-6(2)7(3)8(4)9/h9H,5H2,1-4H3/b7-6-,9-8+ |
| InChIKey | IDMOFDZHSSHICG-NMMTYZSQSA-N |
| XLogP | 2.77 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 125.21 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-3,4-dimethylhex-3-en-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-3,4-dimethylhex-3-en-2-imine?
The IUPAC name of (Z)-3,4-dimethylhex-3-en-2-imine (CID 147896973) is (Z)-3,4-dimethylhex-3-en-2-imine.
What is the SMILES notation for (Z)-3,4-dimethylhex-3-en-2-imine?
The canonical SMILES for (Z)-3,4-dimethylhex-3-en-2-imine is [H]/N=C(C)/C(C)=C(/C)CC.
What is the InChIKey of (Z)-3,4-dimethylhex-3-en-2-imine?
The InChIKey is IDMOFDZHSSHICG-NMMTYZSQSA-N. The full InChI is InChI=1S/C8H15N/c1-5-6(2)7(3)8(4)9/h9H,5H2,1-4H3/b7-6-,9-8+.
What are the key properties of (Z)-3,4-dimethylhex-3-en-2-imine?
(Z)-3,4-dimethylhex-3-en-2-imine has a molecular weight of 125.21 g/mol, XLogP of 2.77, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-3,4-dimethylhex-3-en-2-imine is sourced from PubChem (CID 147896973), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).