C30H37BrF6N2O2 — CID 147897915
2-bromo-N-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]-4-[5,5,5-trifluoro-4-[3-methyl-4-(2-methylpropyl)-5-propylphenyl]pentan-2-yl]benzamide (PubChem CID 147897915) has the molecular formula C30H37BrF6N2O2 and a molecular weight of 651.53 g/mol. Its IUPAC name is 2-bromo-N-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]-4-[5,5,5-trifluoro-4-[3-methyl-4-(2-methylpropyl)-5-propylphenyl]pentan-2-yl]benzamide.
| Compound Name | 2-bromo-N-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]-4-[5,5,5-trifluoro-4-[3-methyl-4-(2-methylpropyl)-5-propylphenyl]pentan-2-yl]benzamide |
|---|---|
| PubChem CID | 147897915 |
| Molecular Formula | C30H37BrF6N2O2 |
| Molecular Weight | 651.53 g/mol |
| Exact Mass | 650.19 |
| IUPAC Name | 2-bromo-N-[2-oxo-2-(2,2,2-trifluoroethylamino)ethyl]-4-[5,5,5-trifluoro-4-[3-methyl-4-(2-methylpropyl)-5-propylphenyl]pentan-2-yl]benzamide |
| SMILES | CCCc1cc(C(CC(C)c2ccc(C(=O)NCC(=O)NCC(F)(F)F)c(Br)c2)C(F)(F)F)cc(C)c1CC(C)C |
| InChI | InChI=1S/C30H37BrF6N2O2/c1-6-7-21-13-22(11-19(5)24(21)10-17(2)3)25(30(35,36)37)12-18(4)20-8-9-23(26(31)14-20)28(41)38-15-27(40)39-16-29(32,33)34/h8-9,11,13-14,17-18,25H,6-7,10,12,15-16H2,1-5H3,(H,38,41)(H,39,40) |
| InChIKey | IDRFQOSLGYATEY-UHFFFAOYSA-N |
| XLogP | 8.16 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.53 |
| LogP ≤ 5 | 8.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |