About N-[(2E)-penta-2,4-dienyl]-N-[(Z)-5-phenylmethoxypent-3-enyl]benzamide
N-[(2E)-penta-2,4-dienyl]-N-[(Z)-5-phenylmethoxypent-3-enyl]benzamide (PubChem CID 14789871) has the molecular formula C24H27NO2
and a molecular weight of 361.49 g/mol. Its IUPAC name is N-[(2E)-penta-2,4-dienyl]-N-[(Z)-5-phenylmethoxypent-3-enyl]benzamide.
Molecular Properties
| Compound Name | N-[(2E)-penta-2,4-dienyl]-N-[(Z)-5-phenylmethoxypent-3-enyl]benzamide |
| PubChem CID | 14789871 |
| Molecular Formula | C24H27NO2 |
| Molecular Weight | 361.49 g/mol |
| Exact Mass | 361.20 |
| IUPAC Name | N-[(2E)-penta-2,4-dienyl]-N-[(Z)-5-phenylmethoxypent-3-enyl]benzamide |
| SMILES | C=C/C=C/CN(CC/C=C\COCc1ccccc1)C(=O)c1ccccc1 |
| InChI | InChI=1S/C24H27NO2/c1-2-3-11-18-25(24(26)23-16-9-5-10-17-23)19-12-6-13-20-27-21-22-14-7-4-8-15-22/h2-11,13-17H,1,12,18-21H2/b11-3+,13-6- |
| InChIKey | RPVBWNAAMNINKP-VEALZJDSSA-N |
| XLogP | 5.03 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 361.49 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-[(2E)-penta-2,4-dienyl]-N-[(Z)-5-phenylmethoxypent-3-enyl]benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(2E)-penta-2,4-dienyl]-N-[(Z)-5-phenylmethoxypent-3-enyl]benzamide?
The IUPAC name of N-[(2E)-penta-2,4-dienyl]-N-[(Z)-5-phenylmethoxypent-3-enyl]benzamide (CID 14789871) is N-[(2E)-penta-2,4-dienyl]-N-[(Z)-5-phenylmethoxypent-3-enyl]benzamide.
What is the SMILES notation for N-[(2E)-penta-2,4-dienyl]-N-[(Z)-5-phenylmethoxypent-3-enyl]benzamide?
The canonical SMILES for N-[(2E)-penta-2,4-dienyl]-N-[(Z)-5-phenylmethoxypent-3-enyl]benzamide is C=C/C=C/CN(CC/C=C\COCc1ccccc1)C(=O)c1ccccc1.
What is the InChIKey of N-[(2E)-penta-2,4-dienyl]-N-[(Z)-5-phenylmethoxypent-3-enyl]benzamide?
The InChIKey is RPVBWNAAMNINKP-VEALZJDSSA-N. The full InChI is InChI=1S/C24H27NO2/c1-2-3-11-18-25(24(26)23-16-9-5-10-17-23)19-12-6-13-20-27-21-22-14-7-4-8-15-22/h2-11,13-17H,1,12,18-21H2/b11-3+,13-6-.
What are the key properties of N-[(2E)-penta-2,4-dienyl]-N-[(Z)-5-phenylmethoxypent-3-enyl]benzamide?
N-[(2E)-penta-2,4-dienyl]-N-[(Z)-5-phenylmethoxypent-3-enyl]benzamide has a molecular weight of 361.49 g/mol, XLogP of 5.03, 11 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(2E)-penta-2,4-dienyl]-N-[(Z)-5-phenylmethoxypent-3-enyl]benzamide is sourced from PubChem (CID 14789871), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).