C26H26ClFN2O2 — CID 147900086
(3S,3'R,3'aS,7'aS)-3'-(3-chloro-2-fluorophenyl)-1'-(cyclopropylmethyl)-6-methylspiro[1H-indole-3,2'-3,3a,5,6,7,7a-hexahydroindole]-2,4'-dione (PubChem CID 147900086) has the molecular formula C26H26ClFN2O2 and a molecular weight of 452.96 g/mol. Its IUPAC name is (3S,3'R,3'aS,7'aS)-3'-(3-chloro-2-fluorophenyl)-1'-(cyclopropylmethyl)-6-methylspiro[1H-indole-3,2'-3,3a,5,6,7,7a-hexahydroindole]-2,4'-dione.
| Compound Name | (3S,3'R,3'aS,7'aS)-3'-(3-chloro-2-fluorophenyl)-1'-(cyclopropylmethyl)-6-methylspiro[1H-indole-3,2'-3,3a,5,6,7,7a-hexahydroindole]-2,4'-dione |
|---|---|
| PubChem CID | 147900086 |
| Molecular Formula | C26H26ClFN2O2 |
| Molecular Weight | 452.96 g/mol |
| Exact Mass | 452.17 |
| IUPAC Name | (3S,3'R,3'aS,7'aS)-3'-(3-chloro-2-fluorophenyl)-1'-(cyclopropylmethyl)-6-methylspiro[1H-indole-3,2'-3,3a,5,6,7,7a-hexahydroindole]-2,4'-dione |
| SMILES | Cc1ccc2c(c1)NC(=O)[C@]21[C@@H](c2cccc(Cl)c2F)[C@@H]2C(=O)CCC[C@@H]2N1CC1CC1 |
| InChI | InChI=1S/C26H26ClFN2O2/c1-14-8-11-17-19(12-14)29-25(32)26(17)23(16-4-2-5-18(27)24(16)28)22-20(6-3-7-21(22)31)30(26)13-15-9-10-15/h2,4-5,8,11-12,15,20,22-23H,3,6-7,9-10,13H2,1H3,(H,29,32)/t20-,22-,23-,26+/m0/s1 |
| InChIKey | IECDEIMNNYJGCT-PETUGJSASA-N |
| XLogP | 5.18 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.96 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |