C29H34N5OS+ — CID 147900117
2-[[4-cyano-12-[4-(1-ethylpiperidin-2-yl)phenyl]-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-8-yl]methoxy]ethyl-dimethylsulfanium (PubChem CID 147900117) has the molecular formula C29H34N5OS+ and a molecular weight of 500.69 g/mol. Its IUPAC name is 2-[[4-cyano-12-[4-(1-ethylpiperidin-2-yl)phenyl]-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-8-yl]methoxy]ethyl-dimethylsulfanium.
| Compound Name | 2-[[4-cyano-12-[4-(1-ethylpiperidin-2-yl)phenyl]-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-8-yl]methoxy]ethyl-dimethylsulfanium |
|---|---|
| PubChem CID | 147900117 |
| Molecular Formula | C29H34N5OS+ |
| Molecular Weight | 500.69 g/mol |
| Exact Mass | 500.25 |
| IUPAC Name | 2-[[4-cyano-12-[4-(1-ethylpiperidin-2-yl)phenyl]-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2(7),3,5,10,12-hexaen-8-yl]methoxy]ethyl-dimethylsulfanium |
| SMILES | CCN1CCCCC1c1ccc(-c2cnc3c(c2)c2cc(C#N)ncc2n3COCC[S+](C)C)cc1 |
| InChI | InChI=1S/C29H34N5OS/c1-4-33-12-6-5-7-27(33)22-10-8-21(9-11-22)23-15-26-25-16-24(17-30)31-19-28(25)34(29(26)32-18-23)20-35-13-14-36(2)3/h8-11,15-16,18-19,27H,4-7,12-14,20H2,1-3H3/q+1 |
| InChIKey | IECHXCLZJJZBCW-UHFFFAOYSA-N |
| XLogP | 5.52 |
| TPSA | 66.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.69 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|