About imidazo[1,5-a]indol-4-imine
imidazo[1,5-a]indol-4-imine (PubChem CID 147900367) has the molecular formula C10H7N3
and a molecular weight of 169.19 g/mol. Its IUPAC name is imidazo[1,5-a]indol-4-imine.
Molecular Properties
| Compound Name | imidazo[1,5-a]indol-4-imine |
| PubChem CID | 147900367 |
| Molecular Formula | C10H7N3 |
| Molecular Weight | 169.19 g/mol |
| Exact Mass | 169.06 |
| IUPAC Name | imidazo[1,5-a]indol-4-imine |
| SMILES | [H]/N=C1/c2ccccc2-n2cncc21 |
| InChI | InChI=1S/C10H7N3/c11-10-7-3-1-2-4-8(7)13-6-12-5-9(10)13/h1-6,11H/b11-10- |
| InChIKey | IEDMEUUAXAIAKV-KHPPLWFESA-N |
| XLogP | 1.60 |
| TPSA | 41.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 169.19 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze imidazo[1,5-a]indol-4-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of imidazo[1,5-a]indol-4-imine?
The IUPAC name of imidazo[1,5-a]indol-4-imine (CID 147900367) is imidazo[1,5-a]indol-4-imine.
What is the SMILES notation for imidazo[1,5-a]indol-4-imine?
The canonical SMILES for imidazo[1,5-a]indol-4-imine is [H]/N=C1/c2ccccc2-n2cncc21.
What is the InChIKey of imidazo[1,5-a]indol-4-imine?
The InChIKey is IEDMEUUAXAIAKV-KHPPLWFESA-N. The full InChI is InChI=1S/C10H7N3/c11-10-7-3-1-2-4-8(7)13-6-12-5-9(10)13/h1-6,11H/b11-10-.
What are the key properties of imidazo[1,5-a]indol-4-imine?
imidazo[1,5-a]indol-4-imine has a molecular weight of 169.19 g/mol, XLogP of 1.60, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for imidazo[1,5-a]indol-4-imine is sourced from PubChem (CID 147900367), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).